C17H13F3N2O3S — CID 6977555
(3R)-3-(2-aminophenyl)sulfanyl-1-[2-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione (PubChem CID 6977555) has the molecular formula C17H13F3N2O3S and a molecular weight of 382.36 g/mol. Its IUPAC name is (3R)-3-(2-aminophenyl)sulfanyl-1-[2-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(2-aminophenyl)sulfanyl-1-[2-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6977555 |
| Molecular Formula | C17H13F3N2O3S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | (3R)-3-(2-aminophenyl)sulfanyl-1-[2-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
| SMILES | Nc1ccccc1S[C@@H]1CC(=O)N(c2ccccc2OC(F)(F)F)C1=O |
| InChI | InChI=1S/C17H13F3N2O3S/c18-17(19,20)25-12-7-3-2-6-11(12)22-15(23)9-14(16(22)24)26-13-8-4-1-5-10(13)21/h1-8,14H,9,21H2/t14-/m1/s1 |
| InChIKey | WMKVQQZRDRIFPX-CQSZACIVSA-N |
| XLogP | 3.59 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|