C19H18N2O4S — CID 98525366
ethyl 4-[(3R)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 98525366) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is ethyl 4-[(3R)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3R)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 98525366 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | ethyl 4-[(3R)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@@H](Sc3ccccc3N)C2=O)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-2-25-19(24)12-7-9-13(10-8-12)21-17(22)11-16(18(21)23)26-15-6-4-3-5-14(15)20/h3-10,16H,2,11,20H2,1H3/t16-/m1/s1 |
| InChIKey | UWZVGRGLQHSMIF-MRXNPFEDSA-N |
| XLogP | 2.87 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|