C23H19N5O4S — CID 92542079
ethyl 4-[(3S)-3-[(6-amino-3,5-dicyano-4-cyclopropyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 92542079) has the molecular formula C23H19N5O4S and a molecular weight of 461.50 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-[(6-amino-3,5-dicyano-4-cyclopropyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-3-[(6-amino-3,5-dicyano-4-cyclopropyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 92542079 |
| Molecular Formula | C23H19N5O4S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | ethyl 4-[(3S)-3-[(6-amino-3,5-dicyano-4-cyclopropyl-2-pyridinyl)sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@H](Sc3nc(N)c(C#N)c(C4CC4)c3C#N)C2=O)cc1 |
| InChI | InChI=1S/C23H19N5O4S/c1-2-32-23(31)13-5-7-14(8-6-13)28-18(29)9-17(22(28)30)33-21-16(11-25)19(12-3-4-12)15(10-24)20(26)27-21/h5-8,12,17H,2-4,9H2,1H3,(H2,26,27)/t17-/m0/s1 |
| InChIKey | UIPANAVZRQRZCK-KRWDZBQOSA-N |
| XLogP | 2.89 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|