C32H27N5O6S — CID 19057952
2-amino-4-cyclopropyl-6-[2,5-dioxo-1-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-3-yl]sulfanylpyridine-3,5-dicarbonitrile (PubChem CID 19057952) has the molecular formula C32H27N5O6S and a molecular weight of 609.66 g/mol. Its IUPAC name is 2-amino-4-cyclopropyl-6-[2,5-dioxo-1-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-3-yl]sulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-cyclopropyl-6-[2,5-dioxo-1-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-3-yl]sulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 19057952 |
| Molecular Formula | C32H27N5O6S |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | 2-amino-4-cyclopropyl-6-[2,5-dioxo-1-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-3-yl]sulfanylpyridine-3,5-dicarbonitrile |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(N3C(=O)CC(Sc4nc(N)c(C#N)c(C5CC5)c4C#N)C3=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C32H27N5O6S/c1-41-24-12-17(13-25(42-2)29(24)43-3)4-11-23(38)18-7-9-20(10-8-18)37-27(39)14-26(32(37)40)44-31-22(16-34)28(19-5-6-19)21(15-33)30(35)36-31/h4,7-13,19,26H,5-6,14H2,1-3H3,(H2,35,36)/b11-4+ |
| InChIKey | GCXSKTGGXNRKQT-NYYWCZLTSA-N |
| XLogP | 4.63 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|