C5H8N4O3 — CID 76845087
2,4-dioxo-1,3-diazinane-5-carbohydrazide (PubChem CID 76845087) has the molecular formula C5H8N4O3 and a molecular weight of 172.14 g/mol. Its IUPAC name is 2,4-dioxo-1,3-diazinane-5-carbohydrazide.
| Compound Name | 2,4-dioxo-1,3-diazinane-5-carbohydrazide |
|---|---|
| PubChem CID | 76845087 |
| Molecular Formula | C5H8N4O3 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 2,4-dioxo-1,3-diazinane-5-carbohydrazide |
| SMILES | NNC(=O)C1CNC(=O)NC1=O |
| InChI | InChI=1S/C5H8N4O3/c6-9-4(11)2-1-7-5(12)8-3(2)10/h2H,1,6H2,(H,9,11)(H2,7,8,10,12) |
| InChIKey | WMAIISJDUCHWRJ-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|