C6H11N3O2 — CID 126970948
6-oxopiperidine-3-carbohydrazide (PubChem CID 126970948) has the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. Its IUPAC name is 6-oxopiperidine-3-carbohydrazide.
| Compound Name | 6-oxopiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 126970948 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 6-oxopiperidine-3-carbohydrazide |
| SMILES | NNC(=O)C1CCC(=O)NC1 |
| InChI | InChI=1S/C6H11N3O2/c7-9-6(11)4-1-2-5(10)8-3-4/h4H,1-3,7H2,(H,8,10)(H,9,11) |
| InChIKey | MRXNKVWAFOKYRR-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|