C12H21N3O2 — CID 103805817
N-[(1R,2R)-2-aminocyclohexyl]-6-oxopiperidine-3-carboxamide (PubChem CID 103805817) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 103805817 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-6-oxopiperidine-3-carboxamide |
| SMILES | N[C@@H]1CCCC[C@H]1NC(=O)C1CCC(=O)NC1 |
| InChI | InChI=1S/C12H21N3O2/c13-9-3-1-2-4-10(9)15-12(17)8-5-6-11(16)14-7-8/h8-10H,1-7,13H2,(H,14,16)(H,15,17)/t8?,9-,10-/m1/s1 |
| InChIKey | JAGREMGXXQUABC-VXRWAFEHSA-N |
| XLogP | -0.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |