C13H24ClN3O2 — CID 119611735
N-[2-(aminomethyl)cyclohexyl]-6-oxopiperidine-3-carboxamide;hydrochloride (PubChem CID 119611735) has the molecular formula C13H24ClN3O2 and a molecular weight of 289.81 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-6-oxopiperidine-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-6-oxopiperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119611735 |
| Molecular Formula | C13H24ClN3O2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-6-oxopiperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)C1CCC(=O)NC1 |
| InChI | InChI=1S/C13H23N3O2.ClH/c14-7-9-3-1-2-4-11(9)16-13(18)10-5-6-12(17)15-8-10;/h9-11H,1-8,14H2,(H,15,17)(H,16,18);1H |
| InChIKey | RRLQQMQZDBBNCN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |