C11H19N3O3 — CID 112728984
N-[3-(dimethylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxamide (PubChem CID 112728984) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-[3-(dimethylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 112728984 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-[3-(dimethylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxamide |
| SMILES | CN(C)C(=O)CCNC(=O)C1CCC(=O)NC1 |
| InChI | InChI=1S/C11H19N3O3/c1-14(2)10(16)5-6-12-11(17)8-3-4-9(15)13-7-8/h8H,3-7H2,1-2H3,(H,12,17)(H,13,15) |
| InChIKey | TWGDBCFZSLTTJJ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |