C12H21N3O4 — CID 112686353
N-[3-(2-methoxyethylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxamide (PubChem CID 112686353) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[3-(2-methoxyethylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[3-(2-methoxyethylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 112686353 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-[3-(2-methoxyethylamino)-3-oxopropyl]-6-oxopiperidine-3-carboxamide |
| SMILES | COCCNC(=O)CCNC(=O)C1CCC(=O)NC1 |
| InChI | InChI=1S/C12H21N3O4/c1-19-7-6-13-11(17)4-5-14-12(18)9-2-3-10(16)15-8-9/h9H,2-8H2,1H3,(H,13,17)(H,14,18)(H,15,16) |
| InChIKey | HQTIZVGRUWYCNO-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|