C16H27N3O2 — CID 73379803
5-(dicyclohexylamino)-1,3-diazinane-2,4-dione (PubChem CID 73379803) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 5-(dicyclohexylamino)-1,3-diazinane-2,4-dione.
| Compound Name | 5-(dicyclohexylamino)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 73379803 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 5-(dicyclohexylamino)-1,3-diazinane-2,4-dione |
| SMILES | O=C1NCC(N(C2CCCCC2)C2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C16H27N3O2/c20-15-14(11-17-16(21)18-15)19(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h12-14H,1-11H2,(H2,17,18,20,21) |
| InChIKey | ZKXJSEPEVBGNIJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |