C15H22O2 — CID 102204168
(3R,3aR,3bR,4R,6aS)-4-hydroxy-3,3a,5,5-tetramethyl-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one (PubChem CID 102204168) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (3R,3aR,3bR,4R,6aS)-4-hydroxy-3,3a,5,5-tetramethyl-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one.
| Compound Name | (3R,3aR,3bR,4R,6aS)-4-hydroxy-3,3a,5,5-tetramethyl-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one |
|---|---|
| PubChem CID | 102204168 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3R,3aR,3bR,4R,6aS)-4-hydroxy-3,3a,5,5-tetramethyl-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one |
| SMILES | C[C@H]1C(=O)C=C2C[C@H]3CC(C)(C)[C@H](O)[C@H]3[C@@]21C |
| InChI | InChI=1S/C15H22O2/c1-8-11(16)6-10-5-9-7-14(2,3)13(17)12(9)15(8,10)4/h6,8-9,12-13,17H,5,7H2,1-4H3/t8-,9-,12-,13+,15+/m0/s1 |
| InChIKey | ZOPGMBGVSLSMAH-WLGFQKAXSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |