C12H16Cl2O — CID 10911852
(1S,2R,5R,7R,8R)-3,4-dichloro-2,8-dimethyltricyclo[5.3.0.02,5]decan-6-one (PubChem CID 10911852) has the molecular formula C12H16Cl2O and a molecular weight of 247.16 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R)-3,4-dichloro-2,8-dimethyltricyclo[5.3.0.02,5]decan-6-one.
| Compound Name | (1S,2R,5R,7R,8R)-3,4-dichloro-2,8-dimethyltricyclo[5.3.0.02,5]decan-6-one |
|---|---|
| PubChem CID | 10911852 |
| Molecular Formula | C12H16Cl2O |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (1S,2R,5R,7R,8R)-3,4-dichloro-2,8-dimethyltricyclo[5.3.0.02,5]decan-6-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]1C(=O)[C@@H]1C(Cl)C(Cl)[C@@]12C |
| InChI | InChI=1S/C12H16Cl2O/c1-5-3-4-6-7(5)10(15)8-9(13)11(14)12(6,8)2/h5-9,11H,3-4H2,1-2H3/t5-,6+,7-,8+,9?,11?,12-/m1/s1 |
| InChIKey | UCOKNBNDIOQWHL-NHWQALOJSA-N |
| XLogP | 3.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|