C17H26N2 — CID 121292951
(4R)-4,8,8,10-tetramethyl-12,14-diazatetracyclo[11.1.1.02,11.03,7]pentadeca-1,12-diene (PubChem CID 121292951) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (4R)-4,8,8,10-tetramethyl-12,14-diazatetracyclo[11.1.1.02,11.03,7]pentadeca-1,12-diene.
| Compound Name | (4R)-4,8,8,10-tetramethyl-12,14-diazatetracyclo[11.1.1.02,11.03,7]pentadeca-1,12-diene |
|---|---|
| PubChem CID | 121292951 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (4R)-4,8,8,10-tetramethyl-12,14-diazatetracyclo[11.1.1.02,11.03,7]pentadeca-1,12-diene |
| SMILES | CC1CC(C)(C)C2CC[C@@H](C)C2C2=C3CC(=NC21)N3 |
| InChI | InChI=1S/C17H26N2/c1-9-5-6-11-14(9)15-12-7-13(18-12)19-16(15)10(2)8-17(11,3)4/h9-11,14,16H,5-8H2,1-4H3,(H,18,19)/t9-,10?,11?,14?,16?/m1/s1 |
| InChIKey | DLHUQDLYQNPHSG-GIBMINKNSA-N |
| XLogP | 3.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |