C13H24 — CID 90723342
1,4,7,7a-tetramethyl-1,2,3,3a,4,5,6,7-octahydroindene (PubChem CID 90723342) has the molecular formula C13H24 and a molecular weight of 180.34 g/mol. Its IUPAC name is 1,4,7,7a-tetramethyl-1,2,3,3a,4,5,6,7-octahydroindene.
| Compound Name | 1,4,7,7a-tetramethyl-1,2,3,3a,4,5,6,7-octahydroindene |
|---|---|
| PubChem CID | 90723342 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1,4,7,7a-tetramethyl-1,2,3,3a,4,5,6,7-octahydroindene |
| SMILES | CC1CCC(C)C2(C)C(C)CCC12 |
| InChI | InChI=1S/C13H24/c1-9-5-6-10(2)13(4)11(3)7-8-12(9)13/h9-12H,5-8H2,1-4H3 |
| InChIKey | GAPFDXCKDQDOFE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |