C12H22 — CID 59130187
(1S,3aS,4S,7aR)-1,4,7a-trimethyl-1,2,3,3a,4,5,6,7-octahydroindene (PubChem CID 59130187) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (1S,3aS,4S,7aR)-1,4,7a-trimethyl-1,2,3,3a,4,5,6,7-octahydroindene.
| Compound Name | (1S,3aS,4S,7aR)-1,4,7a-trimethyl-1,2,3,3a,4,5,6,7-octahydroindene |
|---|---|
| PubChem CID | 59130187 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (1S,3aS,4S,7aR)-1,4,7a-trimethyl-1,2,3,3a,4,5,6,7-octahydroindene |
| SMILES | C[C@H]1CCC[C@]2(C)[C@@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C12H22/c1-9-5-4-8-12(3)10(2)6-7-11(9)12/h9-11H,4-8H2,1-3H3/t9-,10-,11-,12+/m0/s1 |
| InChIKey | ZFJQTEMORIBDHM-FIQHERPVSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |