C14H26 — CID 142806834
1-(1,2-dimethylcyclopentyl)-4-methylcyclohexane (PubChem CID 142806834) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 1-(1,2-dimethylcyclopentyl)-4-methylcyclohexane.
| Compound Name | 1-(1,2-dimethylcyclopentyl)-4-methylcyclohexane |
|---|---|
| PubChem CID | 142806834 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 1-(1,2-dimethylcyclopentyl)-4-methylcyclohexane |
| SMILES | CC1CCC(C2(C)CCCC2C)CC1 |
| InChI | InChI=1S/C14H26/c1-11-6-8-13(9-7-11)14(3)10-4-5-12(14)2/h11-13H,4-10H2,1-3H3 |
| InChIKey | IVYTVIQUSXBPJO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |