C16H36N4O — CID 174842963
1-cyclohexyl-1,2-dimethylcyclohexane;1,1-diaminourea;methane (PubChem CID 174842963) has the molecular formula C16H36N4O and a molecular weight of 300.49 g/mol. Its IUPAC name is 1-cyclohexyl-1,2-dimethylcyclohexane;1,1-diaminourea;methane.
| Compound Name | 1-cyclohexyl-1,2-dimethylcyclohexane;1,1-diaminourea;methane |
|---|---|
| PubChem CID | 174842963 |
| Molecular Formula | C16H36N4O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.29 |
| IUPAC Name | 1-cyclohexyl-1,2-dimethylcyclohexane;1,1-diaminourea;methane |
| SMILES | C.CC1CCCCC1(C)C1CCCCC1.NC(=O)N(N)N |
| InChI | InChI=1S/C14H26.CH6N4O.CH4/c1-12-8-6-7-11-14(12,2)13-9-4-3-5-10-13;2-1(6)5(3)4;/h12-13H,3-11H2,1-2H3;3-4H2,(H2,2,6);1H4 |
| InChIKey | ZWTOYFREMAGHIR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|