C12H22 — CID 169205575
(2R,4aR)-2,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene (PubChem CID 169205575) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (2R,4aR)-2,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene.
| Compound Name | (2R,4aR)-2,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 169205575 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (2R,4aR)-2,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
| SMILES | C[C@@H]1CC[C@H]2CCCCC2(C)C1 |
| InChI | InChI=1S/C12H22/c1-10-6-7-11-5-3-4-8-12(11,2)9-10/h10-11H,3-9H2,1-2H3/t10-,11-,12?/m1/s1 |
| InChIKey | OZCYALLNRZVIHQ-XFKKCKKNSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |