C11H19Cl — CID 640677
(2R,4aR,8aR)-2-chloro-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene (PubChem CID 640677) has the molecular formula C11H19Cl and a molecular weight of 186.73 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-chloro-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene.
| Compound Name | (2R,4aR,8aR)-2-chloro-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 640677 |
| Molecular Formula | C11H19Cl |
| Molecular Weight | 186.73 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (2R,4aR,8aR)-2-chloro-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@@H](Cl)C2 |
| InChI | InChI=1S/C11H19Cl/c1-11-7-3-2-4-9(11)5-6-10(12)8-11/h9-10H,2-8H2,1H3/t9-,10-,11-/m1/s1 |
| InChIKey | QQNQHPISKVULJH-GMTAPVOTSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.73 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|