C9H15F — CID 170095403
(2R,6aS)-2-fluoro-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-pentalene (PubChem CID 170095403) has the molecular formula C9H15F and a molecular weight of 142.22 g/mol. Its IUPAC name is (2R,6aS)-2-fluoro-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-pentalene.
| Compound Name | (2R,6aS)-2-fluoro-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-pentalene |
|---|---|
| PubChem CID | 170095403 |
| Molecular Formula | C9H15F |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | (2R,6aS)-2-fluoro-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-pentalene |
| SMILES | C[C@@]12CCCC1C[C@@H](F)C2 |
| InChI | InChI=1S/C9H15F/c1-9-4-2-3-7(9)5-8(10)6-9/h7-8H,2-6H2,1H3/t7?,8-,9+/m1/s1 |
| InChIKey | KMCKHXNKTXOOLH-ASODMVGOSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |