C13H22OS2 — CID 10106590
(4aR,8aR)-3-[2,2-bis(sulfanyl)ethenyl]-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol (PubChem CID 10106590) has the molecular formula C13H22OS2 and a molecular weight of 258.45 g/mol. Its IUPAC name is (4aR,8aR)-3-[2,2-bis(sulfanyl)ethenyl]-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol.
| Compound Name | (4aR,8aR)-3-[2,2-bis(sulfanyl)ethenyl]-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 10106590 |
| Molecular Formula | C13H22OS2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (4aR,8aR)-3-[2,2-bis(sulfanyl)ethenyl]-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol |
| SMILES | C[C@]12CCCC[C@@H]1CC(O)C(C=C(S)S)C2 |
| InChI | InChI=1S/C13H22OS2/c1-13-5-3-2-4-10(13)7-11(14)9(8-13)6-12(15)16/h6,9-11,14-16H,2-5,7-8H2,1H3/t9?,10-,11?,13-/m1/s1 |
| InChIKey | SOHFDMUWNJIWQV-SPGNQXPMSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|