About 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane
4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane (PubChem CID 164680322) has the molecular formula C19H32
and a molecular weight of 260.46 g/mol. Its IUPAC name is 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane.
Analyze 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane?
The IUPAC name of 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane (CID 164680322) is 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane.
What is the SMILES notation for 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane?
The canonical SMILES for 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane is CC1CCCC2CCC3(C)C(C)CCC4CC1C2C43.
What is the InChIKey of 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane?
The InChIKey is BPFROGHEIKPVPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32/c1-12-5-4-6-14-9-10-19(3)13(2)7-8-15-11-16(12)17(14)18(15)19/h12-18H,4-11H2,1-3H3.
What are the key properties of 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane?
4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane has a molecular weight of 260.46 g/mol, XLogP of 5.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,12-trimethyltetracyclo[11.2.1.05,15.08,14]hexadecane is sourced from PubChem (CID 164680322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).