C14H26O — CID 142805256
[(2S)-2,5,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]methanol (PubChem CID 142805256) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is [(2S)-2,5,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]methanol.
| Compound Name | [(2S)-2,5,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 142805256 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | [(2S)-2,5,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]methanol |
| SMILES | CC1CCCC2(C)C1CC[C@H](C)C2CO |
| InChI | InChI=1S/C14H26O/c1-10-5-4-8-14(3)12(10)7-6-11(2)13(14)9-15/h10-13,15H,4-9H2,1-3H3/t10?,11-,12?,13?,14?/m0/s1 |
| InChIKey | DQIQPZSSHRVYOY-VJGVLAAASA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |