C19H34O — CID 142882338
(E,6R)-6-(4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-2-methylhept-4-en-2-ol (PubChem CID 142882338) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is (E,6R)-6-(4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-2-methylhept-4-en-2-ol.
| Compound Name | (E,6R)-6-(4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-2-methylhept-4-en-2-ol |
|---|---|
| PubChem CID | 142882338 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | (E,6R)-6-(4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-2-methylhept-4-en-2-ol |
| SMILES | CC1CCCC2(C)C1CCC2[C@H](C)/C=C/CC(C)(C)O |
| InChI | InChI=1S/C19H34O/c1-14(8-6-12-18(3,4)20)16-10-11-17-15(2)9-7-13-19(16,17)5/h6,8,14-17,20H,7,9-13H2,1-5H3/b8-6+/t14-,15?,16?,17?,19?/m1/s1 |
| InChIKey | RFVWACWODOMWDU-XRLSKRNVSA-N |
| XLogP | 5.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|