C14H26O — CID 59043396
(2S)-2-[(1R,4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propan-1-ol (PubChem CID 59043396) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (2S)-2-[(1R,4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propan-1-ol.
| Compound Name | (2S)-2-[(1R,4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 59043396 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (2S)-2-[(1R,4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propan-1-ol |
| SMILES | C[C@H](CO)[C@H]1CCC2[C@@H](C)CCC[C@@]21C |
| InChI | InChI=1S/C14H26O/c1-10-5-4-8-14(3)12(10)6-7-13(14)11(2)9-15/h10-13,15H,4-9H2,1-3H3/t10-,11+,12?,13+,14-/m0/s1 |
| InChIKey | CLAMJYABXPJXMR-KUPGAJMDSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |