C17H32O — CID 58987876
(5R)-5-[(1R,3aS,4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexan-1-ol (PubChem CID 58987876) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is (5R)-5-[(1R,3aS,4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexan-1-ol.
| Compound Name | (5R)-5-[(1R,3aS,4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexan-1-ol |
|---|---|
| PubChem CID | 58987876 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | (5R)-5-[(1R,3aS,4S,7aS)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexan-1-ol |
| SMILES | C[C@H](CCCCO)[C@H]1CC[C@H]2[C@@H](C)CCC[C@]12C |
| InChI | InChI=1S/C17H32O/c1-13(7-4-5-12-18)15-9-10-16-14(2)8-6-11-17(15,16)3/h13-16,18H,4-12H2,1-3H3/t13-,14+,15-,16+,17-/m1/s1 |
| InChIKey | FPMKSFIAFBBABQ-BPKGMFCQSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|