C23H42O3 — CID 20576884
ethyl 7-(4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-4-ethyl-3-hydroxyoctanoate (PubChem CID 20576884) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is ethyl 7-(4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-4-ethyl-3-hydroxyoctanoate.
| Compound Name | ethyl 7-(4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-4-ethyl-3-hydroxyoctanoate |
|---|---|
| PubChem CID | 20576884 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | ethyl 7-(4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)-4-ethyl-3-hydroxyoctanoate |
| SMILES | CCOC(=O)CC(O)C(CC)CCC(C)C1CCC2C(C)CCCC21C |
| InChI | InChI=1S/C23H42O3/c1-6-18(21(24)15-22(25)26-7-2)11-10-17(4)20-13-12-19-16(3)9-8-14-23(19,20)5/h16-21,24H,6-15H2,1-5H3 |
| InChIKey | ZTYQISUNOHUYTL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |