C18H30O2 — CID 10684025
(4aR,4bS,7R,8R,8aR,10aR)-8-(hydroxymethyl)-4a,7,8a-trimethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-one (PubChem CID 10684025) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (4aR,4bS,7R,8R,8aR,10aR)-8-(hydroxymethyl)-4a,7,8a-trimethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-one.
| Compound Name | (4aR,4bS,7R,8R,8aR,10aR)-8-(hydroxymethyl)-4a,7,8a-trimethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-one |
|---|---|
| PubChem CID | 10684025 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (4aR,4bS,7R,8R,8aR,10aR)-8-(hydroxymethyl)-4a,7,8a-trimethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@](C)(CC[C@H]3C(=O)CCC[C@]23C)[C@@H]1CO |
| InChI | InChI=1S/C18H30O2/c1-12-6-7-16-17(2)9-4-5-15(20)13(17)8-10-18(16,3)14(12)11-19/h12-14,16,19H,4-11H2,1-3H3/t12-,13+,14-,16-,17+,18+/m1/s1 |
| InChIKey | SRXWVWBYNUYCER-JZUIEXCESA-N |
| XLogP | 3.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |