C22H32O3 — CID 10688836
methyl (5R,8S,9R,10R,13R,14R)-10,13-dimethyl-17-methylidene-4-oxo-1,2,3,5,6,7,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-8-carboxylate (PubChem CID 10688836) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is methyl (5R,8S,9R,10R,13R,14R)-10,13-dimethyl-17-methylidene-4-oxo-1,2,3,5,6,7,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-8-carboxylate.
| Compound Name | methyl (5R,8S,9R,10R,13R,14R)-10,13-dimethyl-17-methylidene-4-oxo-1,2,3,5,6,7,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-8-carboxylate |
|---|---|
| PubChem CID | 10688836 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | methyl (5R,8S,9R,10R,13R,14R)-10,13-dimethyl-17-methylidene-4-oxo-1,2,3,5,6,7,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-8-carboxylate |
| SMILES | C=C1CC[C@H]2[C@]3(C(=O)OC)CC[C@H]4C(=O)CCC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C22H32O3/c1-14-7-8-17-20(14,2)12-10-18-21(3)11-5-6-16(23)15(21)9-13-22(17,18)19(24)25-4/h15,17-18H,1,5-13H2,2-4H3/t15-,17+,18+,20-,21-,22+/m0/s1 |
| InChIKey | RFTQVMZCEUTVQR-XWTWWCFFSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|