C28H48 — CID 15060601
(4R,4aS,6aR,6aR,6bR,8aR,12aS,14aR,14bS)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4,4a,5,6,6a,7,8,8a,9,10,12,12a,13,14,14a-octadecahydropicene (PubChem CID 15060601) has the molecular formula C28H48 and a molecular weight of 384.69 g/mol. Its IUPAC name is (4R,4aS,6aR,6aR,6bR,8aR,12aS,14aR,14bS)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4,4a,5,6,6a,7,8,8a,9,10,12,12a,13,14,14a-octadecahydropicene.
| Compound Name | (4R,4aS,6aR,6aR,6bR,8aR,12aS,14aR,14bS)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4,4a,5,6,6a,7,8,8a,9,10,12,12a,13,14,14a-octadecahydropicene |
|---|---|
| PubChem CID | 15060601 |
| Molecular Formula | C28H48 |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 384.38 |
| IUPAC Name | (4R,4aS,6aR,6aR,6bR,8aR,12aS,14aR,14bS)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4,4a,5,6,6a,7,8,8a,9,10,12,12a,13,14,14a-octadecahydropicene |
| SMILES | C[C@@H]1CCC[C@]2(C)[C@H]3CC[C@@H]4[C@H]5CC(C)(C)CC[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C28H48/c1-19-8-7-14-26(4)22(19)13-17-28(6)24(26)10-9-23-21-18-25(2,3)15-11-20(21)12-16-27(23,28)5/h19-24H,7-18H2,1-6H3/t19-,20-,21+,22+,23-,24-,26+,27-,28-/m1/s1 |
| InChIKey | PHMUZXUQMBRCKE-ZSAXAQPVSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |