C34H57NO3 — CID 144917926
8-[[(5aR)-5a,5b,8,11a-tetramethyl-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]octanoic acid (PubChem CID 144917926) has the molecular formula C34H57NO3 and a molecular weight of 527.83 g/mol. Its IUPAC name is 8-[[(5aR)-5a,5b,8,11a-tetramethyl-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]octanoic acid.
| Compound Name | 8-[[(5aR)-5a,5b,8,11a-tetramethyl-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]octanoic acid |
|---|---|
| PubChem CID | 144917926 |
| Molecular Formula | C34H57NO3 |
| Molecular Weight | 527.83 g/mol |
| Exact Mass | 527.43 |
| IUPAC Name | 8-[[(5aR)-5a,5b,8,11a-tetramethyl-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]octanoic acid |
| SMILES | CC1CCCC2(C)C1CCC1(C)C2CCC2C3CCCC3(C(=O)NCCCCCCCC(=O)O)CC[C@]21C |
| InChI | InChI=1S/C34H57NO3/c1-24-12-10-18-31(2)25(24)17-20-33(4)28(31)16-15-26-27-13-11-19-34(27,22-21-32(26,33)3)30(38)35-23-9-7-5-6-8-14-29(36)37/h24-28H,5-23H2,1-4H3,(H,35,38)(H,36,37)/t24?,25?,26?,27?,28?,31?,32-,33?,34?/m1/s1 |
| InChIKey | QNLYESIAXUAXPM-QVALFXJSSA-N |
| XLogP | 8.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.83 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|