C30H50O3 — CID 144917702
(5aR)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid;prop-2-en-1-ol (PubChem CID 144917702) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is (5aR)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid;prop-2-en-1-ol.
| Compound Name | (5aR)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid;prop-2-en-1-ol |
|---|---|
| PubChem CID | 144917702 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | (5aR)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid;prop-2-en-1-ol |
| SMILES | C=CCO.CC1(C)CCCC2(C)C1CCC1(C)C2CCC2C3CCCC3(C(=O)O)CC[C@]21C |
| InChI | InChI=1S/C27H44O2.C3H6O/c1-23(2)12-7-13-24(3)20(23)11-15-26(5)21(24)10-9-18-19-8-6-14-27(19,22(28)29)17-16-25(18,26)4;1-2-3-4/h18-21H,6-17H2,1-5H3,(H,28,29);2,4H,1,3H2/t18?,19?,20?,21?,24?,25-,26?,27?;/m1./s1 |
| InChIKey | CUDSMDNEOSGLBV-BJSCMJNWSA-N |
| XLogP | 7.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|