C32H52 — CID 143669163
(3aS,5aR,5bR,11aS,13aR)-5a,5b,8,8,11a-pentamethyl-3a-prop-1-en-2-yl-9-prop-2-enyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene (PubChem CID 143669163) has the molecular formula C32H52 and a molecular weight of 436.77 g/mol. Its IUPAC name is (3aS,5aR,5bR,11aS,13aR)-5a,5b,8,8,11a-pentamethyl-3a-prop-1-en-2-yl-9-prop-2-enyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene.
| Compound Name | (3aS,5aR,5bR,11aS,13aR)-5a,5b,8,8,11a-pentamethyl-3a-prop-1-en-2-yl-9-prop-2-enyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene |
|---|---|
| PubChem CID | 143669163 |
| Molecular Formula | C32H52 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.41 |
| IUPAC Name | (3aS,5aR,5bR,11aS,13aR)-5a,5b,8,8,11a-pentamethyl-3a-prop-1-en-2-yl-9-prop-2-enyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene |
| SMILES | C=CCC1CC[C@@]2(C)C(CC[C@]3(C)C2CC[C@@H]2C4CCC[C@]4(C(=C)C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C32H52/c1-9-11-23-15-18-29(6)26(28(23,4)5)16-19-31(8)27(29)14-13-24-25-12-10-17-32(25,22(2)3)21-20-30(24,31)7/h9,23-27H,1-2,10-21H2,3-8H3/t23?,24-,25?,26?,27?,29+,30-,31-,32-/m1/s1 |
| InChIKey | LQXGAAIGABLRLU-RISZQFRTSA-N |
| XLogP | 9.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|