C32H56O3 — CID 142337157
methane;methyl (5aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate;prop-1-ene (PubChem CID 142337157) has the molecular formula C32H56O3 and a molecular weight of 488.80 g/mol. Its IUPAC name is methane;methyl (5aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate;prop-1-ene.
| Compound Name | methane;methyl (5aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate;prop-1-ene |
|---|---|
| PubChem CID | 142337157 |
| Molecular Formula | C32H56O3 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 488.42 |
| IUPAC Name | methane;methyl (5aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate;prop-1-ene |
| SMILES | C.C=CC.COC(=O)C12CCCC1C1CCC3C4(C)CCC(O)C(C)(C)C4CCC3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C28H46O3.C3H6.CH4/c1-24(2)20-11-15-27(5)21(25(20,3)14-12-22(24)29)10-9-18-19-8-7-13-28(19,23(30)31-6)17-16-26(18,27)4;1-3-2;/h18-22,29H,7-17H2,1-6H3;3H,1H2,2H3;1H4/t18?,19?,20?,21?,22?,25?,26-,27?,28?;;/m1../s1 |
| InChIKey | YFXCKGSTVABTIC-RYDJWWEZSA-N |
| XLogP | 8.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|