C31H51ClO2 — CID 10838807
methyl (4aS,6aR,6aR,6bR,8aR,10R,12aR,14aR,14bS)-10-chloro-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate (PubChem CID 10838807) has the molecular formula C31H51ClO2 and a molecular weight of 491.20 g/mol. Its IUPAC name is methyl (4aS,6aR,6aR,6bR,8aR,10R,12aR,14aR,14bS)-10-chloro-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6aR,6bR,8aR,10R,12aR,14aR,14bS)-10-chloro-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 10838807 |
| Molecular Formula | C31H51ClO2 |
| Molecular Weight | 491.20 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | methyl (4aS,6aR,6aR,6bR,8aR,10R,12aR,14aR,14bS)-10-chloro-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)C[C@H]1[C@H]1CC[C@@H]3[C@@]4(C)CC[C@@H](Cl)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C31H51ClO2/c1-26(2)15-17-31(25(33)34-8)18-16-29(6)20(21(31)19-26)9-10-23-28(5)13-12-24(32)27(3,4)22(28)11-14-30(23,29)7/h20-24H,9-19H2,1-8H3/t20-,21+,22+,23-,24-,28+,29-,30-,31+/m1/s1 |
| InChIKey | SXHOSXXKIMMQQD-NWZPQFJUSA-N |
| XLogP | 8.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.20 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|