C27H44O2 — CID 89312768
(3aS,5aR,5bR,9S,11aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carbaldehyde (PubChem CID 89312768) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (3aS,5aR,5bR,9S,11aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carbaldehyde.
| Compound Name | (3aS,5aR,5bR,9S,11aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carbaldehyde |
|---|---|
| PubChem CID | 89312768 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (3aS,5aR,5bR,9S,11aR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carbaldehyde |
| SMILES | CC1(C)C2CC[C@]3(C)C(CCC4C5CCC[C@]5(C=O)CC[C@]43C)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C27H44O2/c1-23(2)20-10-14-26(5)21(24(20,3)13-11-22(23)29)9-8-18-19-7-6-12-27(19,17-28)16-15-25(18,26)4/h17-22,29H,6-16H2,1-5H3/t18?,19?,20?,21?,22-,24-,25+,26+,27+/m0/s1 |
| InChIKey | DDCSLPSSRDTNLK-LGTLINSTSA-N |
| XLogP | 6.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|