C27H42O2 — CID 130413740
(5aR,13bR)-5a,5b,8,8,11a-pentamethyl-9-oxo-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbaldehyde (PubChem CID 130413740) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is (5aR,13bR)-5a,5b,8,8,11a-pentamethyl-9-oxo-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbaldehyde.
| Compound Name | (5aR,13bR)-5a,5b,8,8,11a-pentamethyl-9-oxo-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbaldehyde |
|---|---|
| PubChem CID | 130413740 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | (5aR,13bR)-5a,5b,8,8,11a-pentamethyl-9-oxo-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carbaldehyde |
| SMILES | CC1(C)C(=O)CCC2(C)C1CCC1(C)C2CCC2[C@H]3CCCC3(C=O)CC[C@]21C |
| InChI | InChI=1S/C27H42O2/c1-23(2)20-10-14-26(5)21(24(20,3)13-11-22(23)29)9-8-18-19-7-6-12-27(19,17-28)16-15-25(18,26)4/h17-21H,6-16H2,1-5H3/t18?,19-,20?,21?,24?,25-,26?,27?/m1/s1 |
| InChIKey | USHKQTSHCZLWMQ-QPIYAELKSA-N |
| XLogP | 6.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|