C28H47NO2 — CID 144722497
(3R,5R,9R,14R)-3-(1-imino-2-methylpropan-2-yl)-4,9,10-trimethyl-4-propyl-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylic acid (PubChem CID 144722497) has the molecular formula C28H47NO2 and a molecular weight of 429.69 g/mol. Its IUPAC name is (3R,5R,9R,14R)-3-(1-imino-2-methylpropan-2-yl)-4,9,10-trimethyl-4-propyl-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylic acid.
| Compound Name | (3R,5R,9R,14R)-3-(1-imino-2-methylpropan-2-yl)-4,9,10-trimethyl-4-propyl-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylic acid |
|---|---|
| PubChem CID | 144722497 |
| Molecular Formula | C28H47NO2 |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | (3R,5R,9R,14R)-3-(1-imino-2-methylpropan-2-yl)-4,9,10-trimethyl-4-propyl-2,3,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylic acid |
| SMILES | [H]/N=C/C(C)(C)[C@@H]1CCC2(C)[C@H](CCC3[C@H]4CCCC4(C(=O)O)CC[C@]32C)C1(C)CCC |
| InChI | InChI=1S/C28H47NO2/c1-7-13-25(4)21(24(2,3)18-29)12-15-27(6)22(25)11-10-19-20-9-8-14-28(20,23(30)31)17-16-26(19,27)5/h18-22,29H,7-17H2,1-6H3,(H,30,31)/b29-18+/t19?,20-,21+,22-,25?,26-,27?,28?/m1/s1 |
| InChIKey | BHQXSRSSBSZQTD-NHOVFINBSA-N |
| XLogP | 7.58 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|