C35H48O4 — CID 131967954
(5aR)-9-(4-methoxycarbonylphenyl)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylic acid (PubChem CID 131967954) has the molecular formula C35H48O4 and a molecular weight of 532.77 g/mol. Its IUPAC name is (5aR)-9-(4-methoxycarbonylphenyl)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylic acid.
| Compound Name | (5aR)-9-(4-methoxycarbonylphenyl)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
|---|---|
| PubChem CID | 131967954 |
| Molecular Formula | C35H48O4 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | (5aR)-9-(4-methoxycarbonylphenyl)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| SMILES | COC(=O)c1ccc(C2=CCC3(C)C(CCC4(C)C3CCC3C5CCCC5(C(=O)O)CC[C@]34C)C2(C)C)cc1 |
| InChI | InChI=1S/C35H48O4/c1-31(2)24(22-9-11-23(12-10-22)29(36)39-6)15-18-32(3)27(31)16-19-34(5)28(32)14-13-25-26-8-7-17-35(26,30(37)38)21-20-33(25,34)4/h9-12,15,25-28H,7-8,13-14,16-21H2,1-6H3,(H,37,38)/t25?,26?,27?,28?,32?,33-,34?,35?/m1/s1 |
| InChIKey | DLPCOAGRDOLMFK-JHWKOPCTSA-N |
| XLogP | 8.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |