C36H51NO2 — CID 123260618
methyl 4-(3a-amino-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl)benzoate (PubChem CID 123260618) has the molecular formula C36H51NO2 and a molecular weight of 529.81 g/mol. Its IUPAC name is methyl 4-(3a-amino-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl)benzoate.
| Compound Name | methyl 4-(3a-amino-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl)benzoate |
|---|---|
| PubChem CID | 123260618 |
| Molecular Formula | C36H51NO2 |
| Molecular Weight | 529.81 g/mol |
| Exact Mass | 529.39 |
| IUPAC Name | methyl 4-(3a-amino-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl)benzoate |
| SMILES | C=CC1CCC2(N)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)OC)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C36H51NO2/c1-8-23-15-20-36(37)22-21-34(5)27(30(23)36)13-14-29-33(4)18-16-26(24-9-11-25(12-10-24)31(38)39-7)32(2,3)28(33)17-19-35(29,34)6/h8-12,16,23,27-30H,1,13-15,17-22,37H2,2-7H3 |
| InChIKey | ZIFMOWUGDAHYDQ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.81 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|