C37H53NO2 — CID 144681861
methyl 4-[(1R,5aR,13bR)-3a-amino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoate (PubChem CID 144681861) has the molecular formula C37H53NO2 and a molecular weight of 543.84 g/mol. Its IUPAC name is methyl 4-[(1R,5aR,13bR)-3a-amino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoate.
| Compound Name | methyl 4-[(1R,5aR,13bR)-3a-amino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoate |
|---|---|
| PubChem CID | 144681861 |
| Molecular Formula | C37H53NO2 |
| Molecular Weight | 543.84 g/mol |
| Exact Mass | 543.41 |
| IUPAC Name | methyl 4-[(1R,5aR,13bR)-3a-amino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoate |
| SMILES | C=C(C)[C@@H]1CCC2(N)CC[C@]3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)OC)cc6)C(C)(C)C5CCC43C)[C@@H]12 |
| InChI | InChI=1S/C37H53NO2/c1-23(2)26-15-20-37(38)22-21-35(6)28(31(26)37)13-14-30-34(5)18-16-27(24-9-11-25(12-10-24)32(39)40-8)33(3,4)29(34)17-19-36(30,35)7/h9-12,16,26,28-31H,1,13-15,17-22,38H2,2-8H3/t26-,28?,29?,30?,31+,34?,35+,36?,37?/m0/s1 |
| InChIKey | YWAOPMYURACBJP-IMHWRASNSA-N |
| XLogP | 8.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.84 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|