C41H58N2O4 — CID 123677083
4-[1-ethenyl-5a,5b,8,8,11a-pentamethyl-3a-[(2-morpholin-4-ylacetyl)amino]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 123677083) has the molecular formula C41H58N2O4 and a molecular weight of 642.93 g/mol. Its IUPAC name is 4-[1-ethenyl-5a,5b,8,8,11a-pentamethyl-3a-[(2-morpholin-4-ylacetyl)amino]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[1-ethenyl-5a,5b,8,8,11a-pentamethyl-3a-[(2-morpholin-4-ylacetyl)amino]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 123677083 |
| Molecular Formula | C41H58N2O4 |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 642.44 |
| IUPAC Name | 4-[1-ethenyl-5a,5b,8,8,11a-pentamethyl-3a-[(2-morpholin-4-ylacetyl)amino]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=CC1CCC2(NC(=O)CN3CCOCC3)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C41H58N2O4/c1-7-27-14-19-41(42-34(44)26-43-22-24-47-25-23-43)21-20-39(5)31(35(27)41)12-13-33-38(4)17-15-30(28-8-10-29(11-9-28)36(45)46)37(2,3)32(38)16-18-40(33,39)6/h7-11,15,27,31-33,35H,1,12-14,16-26H2,2-6H3,(H,42,44)(H,45,46) |
| InChIKey | PKYSTVVXBAILKL-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|