C41H61N3O3 — CID 77467650
4-[3a-[2-(dimethylamino)ethylcarbamoylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 77467650) has the molecular formula C41H61N3O3 and a molecular weight of 643.96 g/mol. Its IUPAC name is 4-[3a-[2-(dimethylamino)ethylcarbamoylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[3a-[2-(dimethylamino)ethylcarbamoylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 77467650 |
| Molecular Formula | C41H61N3O3 |
| Molecular Weight | 643.96 g/mol |
| Exact Mass | 643.47 |
| IUPAC Name | 4-[3a-[2-(dimethylamino)ethylcarbamoylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(NC(=O)NCCN(C)C)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C41H61N3O3/c1-26(2)29-16-21-41(43-36(47)42-24-25-44(8)9)23-22-39(6)31(34(29)41)14-15-33-38(5)19-17-30(27-10-12-28(13-11-27)35(45)46)37(3,4)32(38)18-20-40(33,39)7/h10-13,17,29,31-34H,1,14-16,18-25H2,2-9H3,(H,45,46)(H2,42,43,47) |
| InChIKey | QASSSLZQIDWHOB-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.96 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|