C39H57NO4S — CID 77467742
4-[5a,5b,8,8,11a-pentamethyl-3a-(2-methylsulfonylethylamino)-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 77467742) has the molecular formula C39H57NO4S and a molecular weight of 635.96 g/mol. Its IUPAC name is 4-[5a,5b,8,8,11a-pentamethyl-3a-(2-methylsulfonylethylamino)-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[5a,5b,8,8,11a-pentamethyl-3a-(2-methylsulfonylethylamino)-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 77467742 |
| Molecular Formula | C39H57NO4S |
| Molecular Weight | 635.96 g/mol |
| Exact Mass | 635.40 |
| IUPAC Name | 4-[5a,5b,8,8,11a-pentamethyl-3a-(2-methylsulfonylethylamino)-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(NCCS(C)(=O)=O)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C39H57NO4S/c1-25(2)28-15-20-39(40-23-24-45(8,43)44)22-21-37(6)30(33(28)39)13-14-32-36(5)18-16-29(26-9-11-27(12-10-26)34(41)42)35(3,4)31(36)17-19-38(32,37)7/h9-12,16,28,30-33,40H,1,13-15,17-24H2,2-8H3,(H,41,42) |
| InChIKey | BXASDWBQSYBNLZ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.96 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|