C42H62N2O4S — CID 77467823
4-[3a-[2-[(1,1-dioxothiolan-3-yl)amino]ethylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 77467823) has the molecular formula C42H62N2O4S and a molecular weight of 691.04 g/mol. Its IUPAC name is 4-[3a-[2-[(1,1-dioxothiolan-3-yl)amino]ethylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[3a-[2-[(1,1-dioxothiolan-3-yl)amino]ethylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 77467823 |
| Molecular Formula | C42H62N2O4S |
| Molecular Weight | 691.04 g/mol |
| Exact Mass | 690.44 |
| IUPAC Name | 4-[3a-[2-[(1,1-dioxothiolan-3-yl)amino]ethylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(NCCNC3CCS(=O)(=O)C3)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C42H62N2O4S/c1-27(2)31-14-20-42(44-24-23-43-30-17-25-49(47,48)26-30)22-21-40(6)33(36(31)42)12-13-35-39(5)18-15-32(28-8-10-29(11-9-28)37(45)46)38(3,4)34(39)16-19-41(35,40)7/h8-11,15,30-31,33-36,43-44H,1,12-14,16-26H2,2-7H3,(H,45,46) |
| InChIKey | HVZSRQJUPWRYIT-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.04 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|