C40H58N2O3 — CID 123332827
4-[3a-[[2-(dimethylamino)-2-oxoethyl]amino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 123332827) has the molecular formula C40H58N2O3 and a molecular weight of 614.92 g/mol. Its IUPAC name is 4-[3a-[[2-(dimethylamino)-2-oxoethyl]amino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[3a-[[2-(dimethylamino)-2-oxoethyl]amino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 123332827 |
| Molecular Formula | C40H58N2O3 |
| Molecular Weight | 614.92 g/mol |
| Exact Mass | 614.44 |
| IUPAC Name | 4-[3a-[[2-(dimethylamino)-2-oxoethyl]amino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(NCC(=O)N(C)C)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C40H58N2O3/c1-25(2)28-16-21-40(41-24-33(43)42(8)9)23-22-38(6)30(34(28)40)14-15-32-37(5)19-17-29(26-10-12-27(13-11-26)35(44)45)36(3,4)31(37)18-20-39(32,38)7/h10-13,17,28,30-32,34,41H,1,14-16,18-24H2,2-9H3,(H,44,45) |
| InChIKey | QJCHEFBEYSHNEM-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.92 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|