C40H56N2O4 — CID 77467848
4-[3a-[[2-(dimethylamino)-2-oxoacetyl]amino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 77467848) has the molecular formula C40H56N2O4 and a molecular weight of 628.90 g/mol. Its IUPAC name is 4-[3a-[[2-(dimethylamino)-2-oxoacetyl]amino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[3a-[[2-(dimethylamino)-2-oxoacetyl]amino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 77467848 |
| Molecular Formula | C40H56N2O4 |
| Molecular Weight | 628.90 g/mol |
| Exact Mass | 628.42 |
| IUPAC Name | 4-[3a-[[2-(dimethylamino)-2-oxoacetyl]amino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(NC(=O)C(=O)N(C)C)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C40H56N2O4/c1-24(2)27-16-21-40(41-33(43)34(44)42(8)9)23-22-38(6)29(32(27)40)14-15-31-37(5)19-17-28(25-10-12-26(13-11-25)35(45)46)36(3,4)30(37)18-20-39(31,38)7/h10-13,17,27,29-32H,1,14-16,18-23H2,2-9H3,(H,41,43)(H,45,46) |
| InChIKey | CWHIAQGJGCSTDM-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.90 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|