C40H59NO2 — CID 77467799
4-[5a,5b,8,8,11a-pentamethyl-3a-(2-methylpropylamino)-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 77467799) has the molecular formula C40H59NO2 and a molecular weight of 585.92 g/mol. Its IUPAC name is 4-[5a,5b,8,8,11a-pentamethyl-3a-(2-methylpropylamino)-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[5a,5b,8,8,11a-pentamethyl-3a-(2-methylpropylamino)-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 77467799 |
| Molecular Formula | C40H59NO2 |
| Molecular Weight | 585.92 g/mol |
| Exact Mass | 585.45 |
| IUPAC Name | 4-[5a,5b,8,8,11a-pentamethyl-3a-(2-methylpropylamino)-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(NCC(C)C)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C40H59NO2/c1-25(2)24-41-40-21-16-29(26(3)4)34(40)31-14-15-33-37(7)19-17-30(27-10-12-28(13-11-27)35(42)43)36(5,6)32(37)18-20-39(33,9)38(31,8)22-23-40/h10-13,17,25,29,31-34,41H,3,14-16,18-24H2,1-2,4-9H3,(H,42,43) |
| InChIKey | FHUOPAYVFRGGIB-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.92 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|