C42H56N2O5 — CID 123890352
4-[3a-[[(2,6-dioxopiperidine-4-carbonyl)amino]methyl]-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 123890352) has the molecular formula C42H56N2O5 and a molecular weight of 668.92 g/mol. Its IUPAC name is 4-[3a-[[(2,6-dioxopiperidine-4-carbonyl)amino]methyl]-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[3a-[[(2,6-dioxopiperidine-4-carbonyl)amino]methyl]-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 123890352 |
| Molecular Formula | C42H56N2O5 |
| Molecular Weight | 668.92 g/mol |
| Exact Mass | 668.42 |
| IUPAC Name | 4-[3a-[[(2,6-dioxopiperidine-4-carbonyl)amino]methyl]-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=CC1CCC2(CNC(=O)C3CC(=O)NC(=O)C3)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C42H56N2O5/c1-7-25-14-19-42(24-43-36(47)28-22-33(45)44-34(46)23-28)21-20-40(5)30(35(25)42)12-13-32-39(4)17-15-29(26-8-10-27(11-9-26)37(48)49)38(2,3)31(39)16-18-41(32,40)6/h7-11,15,25,28,30-32,35H,1,12-14,16-24H2,2-6H3,(H,43,47)(H,48,49)(H,44,45,46) |
| InChIKey | BDZBSZNQYYVLKG-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.92 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|